C25H18Cl2N4O — CID 126210883
(2S)-2-cyano-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-phenylacetamide (PubChem CID 126210883) has the molecular formula C25H18Cl2N4O and a molecular weight of 461.35 g/mol. Its IUPAC name is (2S)-2-cyano-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-phenylacetamide.
| Compound Name | (2S)-2-cyano-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 126210883 |
| Molecular Formula | C25H18Cl2N4O |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | (2S)-2-cyano-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-phenylacetamide |
| SMILES | N#C[C@@H](C(=O)N/N=C\c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2N4O/c26-20-11-10-18(23(27)12-20)15-31-16-19(21-8-4-5-9-24(21)31)14-29-30-25(32)22(13-28)17-6-2-1-3-7-17/h1-12,14,16,22H,15H2,(H,30,32)/b29-14-/t22-/m1/s1 |
| InChIKey | CLCNKRKCEUAOHU-WGJSBGIVSA-N |
| XLogP | 5.75 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|