C25H21Cl2N3O — CID 126365049
N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(4-methylphenyl)acetamide (PubChem CID 126365049) has the molecular formula C25H21Cl2N3O and a molecular weight of 450.37 g/mol. Its IUPAC name is N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126365049 |
| Molecular Formula | C25H21Cl2N3O |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C\c2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H21Cl2N3O/c1-17-6-8-18(9-7-17)12-25(31)29-28-14-20-16-30(24-5-3-2-4-22(20)24)15-19-10-11-21(26)13-23(19)27/h2-11,13-14,16H,12,15H2,1H3,(H,29,31)/b28-14- |
| InChIKey | CYKWEARRWAKTPH-MUXKCCDJSA-N |
| XLogP | 6.00 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|