C26H24FN3O — CID 92657719
2-(2,4-dimethylphenyl)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]acetamide (PubChem CID 92657719) has the molecular formula C26H24FN3O and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 92657719 |
| Molecular Formula | C26H24FN3O |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C\c2cn(Cc3ccc(F)cc3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C26H24FN3O/c1-18-7-10-21(19(2)13-18)14-26(31)29-28-15-22-17-30(25-6-4-3-5-24(22)25)16-20-8-11-23(27)12-9-20/h3-13,15,17H,14,16H2,1-2H3,(H,29,31)/b28-15- |
| InChIKey | AKTZXNSJWLMTAV-MBTHVWNTSA-N |
| XLogP | 5.14 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|