C26H25N3O — CID 133143816
N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 133143816) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 133143816 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2cn(Cc3ccccc3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C26H25N3O/c1-19-12-13-22(20(2)14-19)15-26(30)28-27-16-23-18-29(17-21-8-4-3-5-9-21)25-11-7-6-10-24(23)25/h3-14,16,18H,15,17H2,1-2H3,(H,28,30)/b27-16+ |
| InChIKey | KNPCAJIFDQBFLI-JVWAILMASA-N |
| XLogP | 5.00 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|