C26H24ClN3O2 — CID 19173360
N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2-(4-chloro-3,5-dimethylphenoxy)acetamide (PubChem CID 19173360) has the molecular formula C26H24ClN3O2 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2-(4-chloro-3,5-dimethylphenoxy)acetamide.
| Compound Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2-(4-chloro-3,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 19173360 |
| Molecular Formula | C26H24ClN3O2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-2-(4-chloro-3,5-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)N/N=C/c2cn(Cc3ccccc3)c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C26H24ClN3O2/c1-18-12-22(13-19(2)26(18)27)32-17-25(31)29-28-14-21-16-30(15-20-8-4-3-5-9-20)24-11-7-6-10-23(21)24/h3-14,16H,15,17H2,1-2H3,(H,29,31)/b28-14+ |
| InChIKey | SWMLCURSMJRJHS-CCVNUDIWSA-N |
| XLogP | 5.49 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|