C30H31ClN4O3 — CID 126016828
(2S)-N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanamide (PubChem CID 126016828) has the molecular formula C30H31ClN4O3 and a molecular weight of 531.06 g/mol. Its IUPAC name is (2S)-N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126016828 |
| Molecular Formula | C30H31ClN4O3 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | (2S)-N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)COc1ccc(Cl)cc1)C(=O)N/N=C\c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C30H31ClN4O3/c1-21(2)16-27(33-29(36)20-38-25-14-12-24(31)13-15-25)30(37)34-32-17-23-19-35(18-22-8-4-3-5-9-22)28-11-7-6-10-26(23)28/h3-15,17,19,21,27H,16,18,20H2,1-2H3,(H,33,36)(H,34,37)/b32-17-/t27-/m0/s1 |
| InChIKey | BPCDOUXYOUKILI-MEMHSENUSA-N |
| XLogP | 5.40 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|