C23H27BrClN3O5 — CID 126019141
(2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanamide (PubChem CID 126019141) has the molecular formula C23H27BrClN3O5 and a molecular weight of 540.84 g/mol. Its IUPAC name is (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126019141 |
| Molecular Formula | C23H27BrClN3O5 |
| Molecular Weight | 540.84 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanamide |
| SMILES | COc1cc(OC)c(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)COc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C23H27BrClN3O5/c1-14(2)9-19(27-22(29)13-33-17-7-5-16(25)6-8-17)23(30)28-26-12-15-10-18(24)21(32-4)11-20(15)31-3/h5-8,10-12,14,19H,9,13H2,1-4H3,(H,27,29)(H,28,30)/b26-12-/t19-/m0/s1 |
| InChIKey | ITONLTJHIPYBTO-ZRNHNWMXSA-N |
| XLogP | 4.18 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|