C25H25ClN4O6 — CID 126018693
(2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methyl-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]pentanamide (PubChem CID 126018693) has the molecular formula C25H25ClN4O6 and a molecular weight of 512.95 g/mol. Its IUPAC name is (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methyl-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]pentanamide.
| Compound Name | (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methyl-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]pentanamide |
|---|---|
| PubChem CID | 126018693 |
| Molecular Formula | C25H25ClN4O6 |
| Molecular Weight | 512.95 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methyl-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)COc1ccc(Cl)cc1)C(=O)N/N=C\c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C25H25ClN4O6/c1-16(2)13-22(28-24(31)15-35-20-9-5-18(26)6-10-20)25(32)29-27-14-21-11-12-23(36-21)17-3-7-19(8-4-17)30(33)34/h3-12,14,16,22H,13,15H2,1-2H3,(H,28,31)(H,29,32)/b27-14-/t22-/m0/s1 |
| InChIKey | HNUYQMWQERISBH-BAAUMNHKSA-N |
| XLogP | 4.57 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|