C27H28Cl2N4O6 — CID 126023318
(2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methyl-N-[(Z)-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]pentanamide (PubChem CID 126023318) has the molecular formula C27H28Cl2N4O6 and a molecular weight of 575.45 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methyl-N-[(Z)-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]pentanamide.
| Compound Name | (2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methyl-N-[(Z)-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]pentanamide |
|---|---|
| PubChem CID | 126023318 |
| Molecular Formula | C27H28Cl2N4O6 |
| Molecular Weight | 575.45 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | (2R)-2-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methyl-N-[(Z)-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]pentanamide |
| SMILES | Cc1ccc(-c2ccc(/C=N\NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](C)Oc3ccc(Cl)cc3Cl)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H28Cl2N4O6/c1-15(2)11-22(31-26(34)17(4)38-25-9-7-19(28)13-21(25)29)27(35)32-30-14-20-8-10-24(39-20)18-6-5-16(3)23(12-18)33(36)37/h5-10,12-15,17,22H,11H2,1-4H3,(H,31,34)(H,32,35)/b30-14-/t17-,22+/m0/s1 |
| InChIKey | RNHHOBHUHQPBEQ-PCYNXEEMSA-N |
| XLogP | 5.92 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|