C28H30Cl2N4O6 — CID 126169513
(2S)-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-N-[(Z)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]pentanamide (PubChem CID 126169513) has the molecular formula C28H30Cl2N4O6 and a molecular weight of 589.48 g/mol. Its IUPAC name is (2S)-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-N-[(Z)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]pentanamide.
| Compound Name | (2S)-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-N-[(Z)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]pentanamide |
|---|---|
| PubChem CID | 126169513 |
| Molecular Formula | C28H30Cl2N4O6 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (2S)-2-[4-(2,4-dichlorophenoxy)butanoylamino]-4-methyl-N-[(Z)-[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]pentanamide |
| SMILES | Cc1c(-c2ccc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)CCCOc3ccc(Cl)cc3Cl)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H30Cl2N4O6/c1-17(2)14-23(32-27(35)8-5-13-39-26-11-9-19(29)15-22(26)30)28(36)33-31-16-20-10-12-25(40-20)21-6-4-7-24(18(21)3)34(37)38/h4,6-7,9-12,15-17,23H,5,8,13-14H2,1-3H3,(H,32,35)(H,33,36)/b31-16-/t23-/m0/s1 |
| InChIKey | NWYNWPWIERFXAT-VFAPTGNGSA-N |
| XLogP | 6.31 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|