C25H24Cl3N3O4 — CID 126026692
(2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylpentanamide (PubChem CID 126026692) has the molecular formula C25H24Cl3N3O4 and a molecular weight of 536.84 g/mol. Its IUPAC name is (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126026692 |
| Molecular Formula | C25H24Cl3N3O4 |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)COc1ccc(Cl)cc1)C(=O)N/N=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C25H24Cl3N3O4/c1-15(2)11-22(30-24(32)14-34-18-6-3-16(26)4-7-18)25(33)31-29-13-19-8-10-23(35-19)20-9-5-17(27)12-21(20)28/h3-10,12-13,15,22H,11,14H2,1-2H3,(H,30,32)(H,31,33)/b29-13-/t22-/m0/s1 |
| InChIKey | ZIBOJQLOZSRHFP-DHCNTSDESA-N |
| XLogP | 5.97 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|