C22H20Cl2N2O3 — CID 25247238
N-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide (PubChem CID 25247238) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is N-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide.
| Compound Name | N-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 25247238 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)N/N=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)c1C |
| InChI | InChI=1S/C22H20Cl2N2O3/c1-13-4-5-14(2)22(15(13)3)28-12-21(27)26-25-11-17-7-9-20(29-17)18-8-6-16(23)10-19(18)24/h4-11H,12H2,1-3H3,(H,26,27)/b25-11+ |
| InChIKey | KIBDZBGEAWOYTA-OPEKNORGSA-N |
| XLogP | 5.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|