C22H20ClN3O5 — CID 50929903
N-[(E)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide (PubChem CID 50929903) has the molecular formula C22H20ClN3O5 and a molecular weight of 441.87 g/mol. Its IUPAC name is N-[(E)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide.
| Compound Name | N-[(E)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 50929903 |
| Molecular Formula | C22H20ClN3O5 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-[(E)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)N/N=C/c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)c1C |
| InChI | InChI=1S/C22H20ClN3O5/c1-13-4-5-14(2)22(15(13)3)30-12-21(27)25-24-11-17-7-9-20(31-17)18-8-6-16(26(28)29)10-19(18)23/h4-11H,12H2,1-3H3,(H,25,27)/b24-11+ |
| InChIKey | VIDADJDRXRGUHW-BHGWPJFGSA-N |
| XLogP | 4.96 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|