C19H11Br3ClN3O5 — CID 99654874
N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 99654874) has the molecular formula C19H11Br3ClN3O5 and a molecular weight of 636.48 g/mol. Its IUPAC name is N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 99654874 |
| Molecular Formula | C19H11Br3ClN3O5 |
| Molecular Weight | 636.48 g/mol |
| Exact Mass | 632.79 |
| IUPAC Name | N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)N/N=C\c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C19H11Br3ClN3O5/c20-10-5-14(21)19(15(22)6-10)30-9-18(27)25-24-8-12-2-4-17(31-12)13-3-1-11(26(28)29)7-16(13)23/h1-8H,9H2,(H,25,27)/b24-8- |
| InChIKey | UROALTBVEQGNMO-GYRAYZOKSA-N |
| XLogP | 6.32 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.48 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|