C20H15Br2N3O5 — CID 3398773
2-(2,6-dibromo-4-methylphenoxy)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 3398773) has the molecular formula C20H15Br2N3O5 and a molecular weight of 537.16 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methylphenoxy)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,6-dibromo-4-methylphenoxy)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3398773 |
| Molecular Formula | C20H15Br2N3O5 |
| Molecular Weight | 537.16 g/mol |
| Exact Mass | 534.94 |
| IUPAC Name | 2-(2,6-dibromo-4-methylphenoxy)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(Br)c(OCC(=O)NN=Cc2ccc(-c3ccc([N+](=O)[O-])cc3)o2)c(Br)c1 |
| InChI | InChI=1S/C20H15Br2N3O5/c1-12-8-16(21)20(17(22)9-12)29-11-19(26)24-23-10-15-6-7-18(30-15)13-2-4-14(5-3-13)25(27)28/h2-10H,11H2,1H3,(H,24,26) |
| InChIKey | NCTOYGDGMJDFRV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.16 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|