C22H17Br3N2O5 — CID 44615970
ethyl 4-[5-[(E)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 44615970) has the molecular formula C22H17Br3N2O5 and a molecular weight of 629.10 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 44615970 |
| Molecular Formula | C22H17Br3N2O5 |
| Molecular Weight | 629.10 g/mol |
| Exact Mass | 625.87 |
| IUPAC Name | ethyl 4-[5-[(E)-[[2-(2,4,6-tribromophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N/NC(=O)COc3c(Br)cc(Br)cc3Br)o2)cc1 |
| InChI | InChI=1S/C22H17Br3N2O5/c1-2-30-22(29)14-5-3-13(4-6-14)19-8-7-16(32-19)11-26-27-20(28)12-31-21-17(24)9-15(23)10-18(21)25/h3-11H,2,12H2,1H3,(H,27,28)/b26-11+ |
| InChIKey | DZSTVDWKGRUGLE-KBKYJPHKSA-N |
| XLogP | 5.94 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.10 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|