C26H21BrN2O4 — CID 51901785
ethyl 4-[5-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 51901785) has the molecular formula C26H21BrN2O4 and a molecular weight of 505.37 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 51901785 |
| Molecular Formula | C26H21BrN2O4 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | ethyl 4-[5-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N\NC(=O)Cc3ccc(Br)c4ccccc34)o2)cc1 |
| InChI | InChI=1S/C26H21BrN2O4/c1-2-32-26(31)18-9-7-17(8-10-18)24-14-12-20(33-24)16-28-29-25(30)15-19-11-13-23(27)22-6-4-3-5-21(19)22/h3-14,16H,2,15H2,1H3,(H,29,30)/b28-16- |
| InChIKey | JEVLAGMCADGXRT-NTFVMDSBSA-N |
| XLogP | 5.73 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|