C29H24N2O4S — CID 3757485
ethyl 4-[5-[[[2-(9H-fluoren-9-ylsulfanyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 3757485) has the molecular formula C29H24N2O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is ethyl 4-[5-[[[2-(9H-fluoren-9-ylsulfanyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[[2-(9H-fluoren-9-ylsulfanyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3757485 |
| Molecular Formula | C29H24N2O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | ethyl 4-[5-[[[2-(9H-fluoren-9-ylsulfanyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=NNC(=O)CSC3c4ccccc4-c4ccccc43)o2)cc1 |
| InChI | InChI=1S/C29H24N2O4S/c1-2-34-29(33)20-13-11-19(12-14-20)26-16-15-21(35-26)17-30-31-27(32)18-36-28-24-9-5-3-7-22(24)23-8-4-6-10-25(23)28/h3-17,28H,2,18H2,1H3,(H,31,32) |
| InChIKey | IWDTUIFHNCRJSF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|