C22H19ClN2O4S — CID 94831827
ethyl 4-[5-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 94831827) has the molecular formula C22H19ClN2O4S and a molecular weight of 442.92 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 94831827 |
| Molecular Formula | C22H19ClN2O4S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | ethyl 4-[5-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N\NC(=O)CSc3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C22H19ClN2O4S/c1-2-28-22(27)16-5-3-15(4-6-16)20-12-9-18(29-20)13-24-25-21(26)14-30-19-10-7-17(23)8-11-19/h3-13H,2,14H2,1H3,(H,25,26)/b24-13- |
| InChIKey | KYHJRDYNOCDHTE-CFRMEGHHSA-N |
| XLogP | 5.02 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|