C28H24ClN3O6S — CID 126035217
ethyl 4-[5-[(Z)-[[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 126035217) has the molecular formula C28H24ClN3O6S and a molecular weight of 566.04 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126035217 |
| Molecular Formula | C28H24ClN3O6S |
| Molecular Weight | 566.04 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | ethyl 4-[5-[(Z)-[[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N\NC(=O)CN(c3ccccc3)S(=O)(=O)c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C28H24ClN3O6S/c1-2-37-28(34)21-10-8-20(9-11-21)26-17-14-24(38-26)18-30-31-27(33)19-32(23-6-4-3-5-7-23)39(35,36)25-15-12-22(29)13-16-25/h3-18H,2,19H2,1H3,(H,31,33)/b30-18- |
| InChIKey | SLPWDIZMHJQGEV-YKQZZPSBSA-N |
| XLogP | 5.12 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.04 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|