C27H24N4O6S — CID 6040364
ethyl 4-[5-[(Z)-[[2-[benzenesulfonyl(pyridin-2-yl)amino]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 6040364) has the molecular formula C27H24N4O6S and a molecular weight of 532.58 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[[2-[benzenesulfonyl(pyridin-2-yl)amino]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[[2-[benzenesulfonyl(pyridin-2-yl)amino]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6040364 |
| Molecular Formula | C27H24N4O6S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | ethyl 4-[5-[(Z)-[[2-[benzenesulfonyl(pyridin-2-yl)amino]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N\NC(=O)CN(c3ccccn3)S(=O)(=O)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C27H24N4O6S/c1-2-36-27(33)21-13-11-20(12-14-21)24-16-15-22(37-24)18-29-30-26(32)19-31(25-10-6-7-17-28-25)38(34,35)23-8-4-3-5-9-23/h3-18H,2,19H2,1H3,(H,30,32)/b29-18- |
| InChIKey | DYLCOCNRCZGKIK-MIXAMLLLSA-N |
| XLogP | 3.86 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|