C27H23ClN4O7S — CID 6876748
2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 6876748) has the molecular formula C27H23ClN4O7S and a molecular weight of 583.02 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6876748 |
| Molecular Formula | C27H23ClN4O7S |
| Molecular Weight | 583.02 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | 2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C/c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)S(=O)(=O)c2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C27H23ClN4O7S/c1-18-3-11-23(12-4-18)40(36,37)31(21-9-13-26(38-2)24(28)15-21)17-27(33)30-29-16-22-10-14-25(39-22)19-5-7-20(8-6-19)32(34)35/h3-16H,17H2,1-2H3,(H,30,33)/b29-16+ |
| InChIKey | JPDMILCZHPOQOV-MUFRIFMGSA-N |
| XLogP | 5.17 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.02 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|