C26H26ClN3O8S — CID 126189834
[4-[(Z)-[[2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate (PubChem CID 126189834) has the molecular formula C26H26ClN3O8S and a molecular weight of 576.03 g/mol. Its IUPAC name is [4-[(Z)-[[2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate.
| Compound Name | [4-[(Z)-[[2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 126189834 |
| Molecular Formula | C26H26ClN3O8S |
| Molecular Weight | 576.03 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | [4-[(Z)-[[2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(/C=N\NC(=O)CN(c2ccc(OC)c(Cl)c2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C26H26ClN3O8S/c1-17-5-9-20(10-6-17)39(33,34)30(19-8-12-22(35-2)21(27)14-19)16-25(31)29-28-15-18-7-11-23(24(13-18)36-3)38-26(32)37-4/h5-15H,16H2,1-4H3,(H,29,31)/b28-15- |
| InChIKey | BZNWMDHEVXBGPV-MBTHVWNTSA-N |
| XLogP | 4.16 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.03 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|