C24H21Cl2N3O7S — CID 6310929
[4-[(Z)-[[2-[N-(benzenesulfonyl)-2,4-dichloroanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate (PubChem CID 6310929) has the molecular formula C24H21Cl2N3O7S and a molecular weight of 566.42 g/mol. Its IUPAC name is [4-[(Z)-[[2-[N-(benzenesulfonyl)-2,4-dichloroanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate.
| Compound Name | [4-[(Z)-[[2-[N-(benzenesulfonyl)-2,4-dichloroanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 6310929 |
| Molecular Formula | C24H21Cl2N3O7S |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | [4-[(Z)-[[2-[N-(benzenesulfonyl)-2,4-dichloroanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(/C=N\NC(=O)CN(c2ccc(Cl)cc2Cl)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H21Cl2N3O7S/c1-34-22-12-16(8-11-21(22)36-24(31)35-2)14-27-28-23(30)15-29(20-10-9-17(25)13-19(20)26)37(32,33)18-6-4-3-5-7-18/h3-14H,15H2,1-2H3,(H,28,30)/b27-14- |
| InChIKey | JTTGIZBZGIGJMK-VYYCAZPPSA-N |
| XLogP | 4.49 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|