C22H19Cl2N3O3S2 — CID 92661254
2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide (PubChem CID 92661254) has the molecular formula C22H19Cl2N3O3S2 and a molecular weight of 508.45 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92661254 |
| Molecular Formula | C22H19Cl2N3O3S2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide |
| SMILES | CSc1ccc(/C=N\NC(=O)CN(c2ccc(Cl)cc2Cl)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O3S2/c1-31-18-10-7-16(8-11-18)14-25-26-22(28)15-27(21-12-9-17(23)13-20(21)24)32(29,30)19-5-3-2-4-6-19/h2-14H,15H2,1H3,(H,26,28)/b25-14- |
| InChIKey | IENYQJKRIBAFSW-QFEZKATASA-N |
| XLogP | 5.06 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|