C25H24ClN3O4S2 — CID 3616947
2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide (PubChem CID 3616947) has the molecular formula C25H24ClN3O4S2 and a molecular weight of 530.07 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3616947 |
| Molecular Formula | C25H24ClN3O4S2 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
| SMILES | Cc1cc(Cl)ccc1N(CC(=O)NN=Cc1ccc(OC2CSC2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24ClN3O4S2/c1-18-13-20(26)9-12-24(18)29(35(31,32)23-5-3-2-4-6-23)15-25(30)28-27-14-19-7-10-21(11-8-19)33-22-16-34-17-22/h2-14,22H,15-17H2,1H3,(H,28,30) |
| InChIKey | UPFKIAFDYBPZSD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|