C26H27N3O4S2 — CID 3914152
2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide (PubChem CID 3914152) has the molecular formula C26H27N3O4S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is 2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3914152 |
| Molecular Formula | C26H27N3O4S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NN=Cc2ccc(OC3CSC3)cc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C26H27N3O4S2/c1-19-7-13-24(14-8-19)35(31,32)29(25-6-4-3-5-20(25)2)16-26(30)28-27-15-21-9-11-22(12-10-21)33-23-17-34-18-23/h3-15,23H,16-18H2,1-2H3,(H,28,30) |
| InChIKey | AVIWDSSROACOSC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|