C27H29N3O4S2 — CID 3108701
2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide (PubChem CID 3108701) has the molecular formula C27H29N3O4S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3108701 |
| Molecular Formula | C27H29N3O4S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
| SMILES | CC(C)c1ccc(N(CC(=O)NN=Cc2ccc(OC3CSC3)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O4S2/c1-20(2)22-10-12-23(13-11-22)30(36(32,33)26-6-4-3-5-7-26)17-27(31)29-28-16-21-8-14-24(15-9-21)34-25-18-35-19-25/h3-16,20,25H,17-19H2,1-2H3,(H,29,31) |
| InChIKey | CTIZHTOIXWWYFS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|