C28H27N3O3S — CID 4626255
2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-(naphthalen-1-ylmethylideneamino)acetamide (PubChem CID 4626255) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-(naphthalen-1-ylmethylideneamino)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-(naphthalen-1-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 4626255 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-(naphthalen-1-ylmethylideneamino)acetamide |
| SMILES | CC(C)c1ccc(N(CC(=O)NN=Cc2cccc3ccccc23)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27N3O3S/c1-21(2)22-15-17-25(18-16-22)31(35(33,34)26-12-4-3-5-13-26)20-28(32)30-29-19-24-11-8-10-23-9-6-7-14-27(23)24/h3-19,21H,20H2,1-2H3,(H,30,32) |
| InChIKey | YIDJGBITJRDTNA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|