C24H24IN3O6S — CID 126125104
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 126125104) has the molecular formula C24H24IN3O6S and a molecular weight of 609.44 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126125104 |
| Molecular Formula | C24H24IN3O6S |
| Molecular Weight | 609.44 g/mol |
| Exact Mass | 609.04 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CN(c2ccc(I)cc2)S(=O)(=O)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C24H24IN3O6S/c1-32-21-14-9-17(23(33-2)24(21)34-3)15-26-27-22(29)16-28(19-12-10-18(25)11-13-19)35(30,31)20-7-5-4-6-8-20/h4-15H,16H2,1-3H3,(H,27,29)/b26-15- |
| InChIKey | QWJGWYKBUNFQJH-YSMPRRRNSA-N |
| XLogP | 3.66 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|