C25H26ClN3O6S — CID 126125509
2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 126125509) has the molecular formula C25H26ClN3O6S and a molecular weight of 532.02 g/mol. Its IUPAC name is 2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126125509 |
| Molecular Formula | C25H26ClN3O6S |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CN(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C25H26ClN3O6S/c1-33-22-14-11-19(24(34-2)25(22)35-3)15-27-28-23(30)17-29(16-18-9-12-20(26)13-10-18)36(31,32)21-7-5-4-6-8-21/h4-15H,16-17H2,1-3H3,(H,28,30)/b27-15- |
| InChIKey | RXKLVSLSQHGOJD-DICXZTSXSA-N |
| XLogP | 3.71 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|