C25H25Cl2N3O6S — CID 126067540
2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 126067540) has the molecular formula C25H25Cl2N3O6S and a molecular weight of 566.46 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126067540 |
| Molecular Formula | C25H25Cl2N3O6S |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN(Cc2cccc(Cl)c2)S(=O)(=O)c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H25Cl2N3O6S/c1-34-22-12-18(13-23(35-2)25(22)36-3)14-28-29-24(31)16-30(15-17-5-4-6-20(27)11-17)37(32,33)21-9-7-19(26)8-10-21/h4-14H,15-16H2,1-3H3,(H,29,31)/b28-14- |
| InChIKey | WHAPWHOUBQJGJW-MUXKCCDJSA-N |
| XLogP | 4.36 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|