C24H23Cl2N3O5S — CID 137065178
2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 137065178) has the molecular formula C24H23Cl2N3O5S and a molecular weight of 536.44 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137065178 |
| Molecular Formula | C24H23Cl2N3O5S |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cccc(/C=N\NC(=O)CN(Cc2cccc(Cl)c2)S(=O)(=O)c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C24H23Cl2N3O5S/c1-2-34-22-8-4-6-18(24(22)31)14-27-28-23(30)16-29(15-17-5-3-7-20(26)13-17)35(32,33)21-11-9-19(25)10-12-21/h3-14,31H,2,15-16H2,1H3,(H,28,30)/b27-14- |
| InChIKey | KWNUCZANKJQWNQ-VYYCAZPPSA-N |
| XLogP | 4.44 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|