C23H21Cl2N3O5S — CID 137138074
2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 137138074) has the molecular formula C23H21Cl2N3O5S and a molecular weight of 522.41 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137138074 |
| Molecular Formula | C23H21Cl2N3O5S |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(/C=N\NC(=O)CN(Cc2cccc(Cl)c2)S(=O)(=O)c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C23H21Cl2N3O5S/c1-33-21-7-3-5-17(23(21)30)13-26-27-22(29)15-28(14-16-4-2-6-19(25)12-16)34(31,32)20-10-8-18(24)9-11-20/h2-13,30H,14-15H2,1H3,(H,27,29)/b26-13- |
| InChIKey | VFUDOAKCDATBGO-ZMFRSBBQSA-N |
| XLogP | 4.05 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|