C27H29Cl2N3O5S — CID 126068787
2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide (PubChem CID 126068787) has the molecular formula C27H29Cl2N3O5S and a molecular weight of 578.52 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126068787 |
| Molecular Formula | C27H29Cl2N3O5S |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)CN(Cc2cccc(Cl)c2)S(=O)(=O)c2ccc(Cl)cc2)cc1OCC |
| InChI | InChI=1S/C27H29Cl2N3O5S/c1-3-14-37-25-13-8-20(16-26(25)36-4-2)17-30-31-27(33)19-32(18-21-6-5-7-23(29)15-21)38(34,35)24-11-9-22(28)10-12-24/h5-13,15-17H,3-4,14,18-19H2,1-2H3,(H,31,33)/b30-17- |
| InChIKey | TYYFCZGCPKUEIA-LQNQUEJISA-N |
| XLogP | 5.52 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|