C28H31ClFN3O5S — CID 126072290
2-[(2-chloro-6-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide (PubChem CID 126072290) has the molecular formula C28H31ClFN3O5S and a molecular weight of 576.09 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126072290 |
| Molecular Formula | C28H31ClFN3O5S |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)CN(Cc2c(F)cccc2Cl)S(=O)(=O)c2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C28H31ClFN3O5S/c1-4-15-38-26-14-11-21(16-27(26)37-5-2)17-31-32-28(34)19-33(18-23-24(29)7-6-8-25(23)30)39(35,36)22-12-9-20(3)10-13-22/h6-14,16-17H,4-5,15,18-19H2,1-3H3,(H,32,34)/b31-17- |
| InChIKey | GIFPWQOTKWYNOR-LJUMEUDFSA-N |
| XLogP | 5.32 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|