C24H23Cl2N3O4S — CID 126063696
2-[(2,6-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 126063696) has the molecular formula C24H23Cl2N3O4S and a molecular weight of 520.44 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126063696 |
| Molecular Formula | C24H23Cl2N3O4S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-(3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(/C=N\NC(=O)CN(Cc2c(Cl)cccc2Cl)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H23Cl2N3O4S/c1-17-9-11-20(12-10-17)34(31,32)29(15-21-22(25)7-4-8-23(21)26)16-24(30)28-27-14-18-5-3-6-19(13-18)33-2/h3-14H,15-16H2,1-2H3,(H,28,30)/b27-14- |
| InChIKey | VPJWUYQFKSHEAT-VYYCAZPPSA-N |
| XLogP | 4.65 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|