C25H22Cl3N3O4S — CID 126014004
2-[(4-chlorophenyl)sulfonyl-[(2,6-dichlorophenyl)methyl]amino]-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]acetamide (PubChem CID 126014004) has the molecular formula C25H22Cl3N3O4S and a molecular weight of 566.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[(2,6-dichlorophenyl)methyl]amino]-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[(2,6-dichlorophenyl)methyl]amino]-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126014004 |
| Molecular Formula | C25H22Cl3N3O4S |
| Molecular Weight | 566.89 g/mol |
| Exact Mass | 565.04 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[(2,6-dichlorophenyl)methyl]amino]-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCOc1cccc(/C=N\NC(=O)CN(Cc2c(Cl)cccc2Cl)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H22Cl3N3O4S/c1-2-13-35-20-6-3-5-18(14-20)15-29-30-25(32)17-31(16-22-23(27)7-4-8-24(22)28)36(33,34)21-11-9-19(26)10-12-21/h2-12,14-15H,1,13,16-17H2,(H,30,32)/b29-15- |
| InChIKey | WGNIJLJUUJINCS-FDVSRXAVSA-N |
| XLogP | 5.55 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.89 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|