C25H25Cl2N3O5S — CID 126116889
2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 126116889) has the molecular formula C25H25Cl2N3O5S and a molecular weight of 550.46 g/mol. Its IUPAC name is 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126116889 |
| Molecular Formula | C25H25Cl2N3O5S |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)CN(Cc2ccccc2)S(=O)(=O)c2cc(Cl)ccc2Cl)cc1OC |
| InChI | InChI=1S/C25H25Cl2N3O5S/c1-3-35-22-12-9-19(13-23(22)34-2)15-28-29-25(31)17-30(16-18-7-5-4-6-8-18)36(32,33)24-14-20(26)10-11-21(24)27/h4-15H,3,16-17H2,1-2H3,(H,29,31)/b28-15- |
| InChIKey | WNGDMQNTDRJNMC-MBTHVWNTSA-N |
| XLogP | 4.74 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|