C25H23Cl2N3O5S — CID 126019406
methyl 4-[(Z)-[[2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 126019406) has the molecular formula C25H23Cl2N3O5S and a molecular weight of 548.45 g/mol. Its IUPAC name is methyl 4-[(Z)-[[2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[[2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 126019406 |
| Molecular Formula | C25H23Cl2N3O5S |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | methyl 4-[(Z)-[[2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\NC(=O)CN(CCc2ccccc2)S(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H23Cl2N3O5S/c1-35-25(32)20-9-7-19(8-10-20)16-28-29-24(31)17-30(14-13-18-5-3-2-4-6-18)36(33,34)23-15-21(26)11-12-22(23)27/h2-12,15-16H,13-14,17H2,1H3,(H,29,31)/b28-16- |
| InChIKey | LCQGYJIURLUWKN-NTFVMDSBSA-N |
| XLogP | 4.16 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|