C22H19BrCl2N2O3S — CID 126016058
N-(4-bromophenyl)-2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 126016058) has the molecular formula C22H19BrCl2N2O3S and a molecular weight of 542.28 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 126016058 |
| Molecular Formula | C22H19BrCl2N2O3S |
| Molecular Weight | 542.28 g/mol |
| Exact Mass | 539.97 |
| IUPAC Name | N-(4-bromophenyl)-2-[(2,5-dichlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | O=C(CN(CCc1ccccc1)S(=O)(=O)c1cc(Cl)ccc1Cl)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H19BrCl2N2O3S/c23-17-6-9-19(10-7-17)26-22(28)15-27(13-12-16-4-2-1-3-5-16)31(29,30)21-14-18(24)8-11-20(21)25/h1-11,14H,12-13,15H2,(H,26,28) |
| InChIKey | AFKQUDBFVPRZFY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.28 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |