C25H25Cl2N3O4S — CID 4969009
2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 4969009) has the molecular formula C25H25Cl2N3O4S and a molecular weight of 534.47 g/mol. Its IUPAC name is 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4969009 |
| Molecular Formula | C25H25Cl2N3O4S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1cc(Cl)ccc1Cl)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H25Cl2N3O4S/c26-20-6-11-23(27)24(16-20)35(32,33)30(17-19-4-2-1-3-5-19)18-25(31)28-21-7-9-22(10-8-21)29-12-14-34-15-13-29/h1-11,16H,12-15,17-18H2,(H,28,31) |
| InChIKey | XLDQDAUFUDXDSN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|