C20H23Cl2N3O2 — CID 8592972
2-[(2,4-dichlorophenyl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 8592972) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 8592972 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-24(13-15-2-3-16(21)12-19(15)22)14-20(26)23-17-4-6-18(7-5-17)25-8-10-27-11-9-25/h2-7,12H,8-11,13-14H2,1H3,(H,23,26) |
| InChIKey | MPWCSOSIIXWBCZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|