C22H25Cl2N3O4 — CID 25336598
(2S)-2-(2,4-dichlorophenoxy)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide (PubChem CID 25336598) has the molecular formula C22H25Cl2N3O4 and a molecular weight of 466.37 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 25336598 |
| Molecular Formula | C22H25Cl2N3O4 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)N(C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O4/c1-15(31-20-8-3-16(23)13-19(20)24)22(29)26(2)14-21(28)25-17-4-6-18(7-5-17)27-9-11-30-12-10-27/h3-8,13,15H,9-12,14H2,1-2H3,(H,25,28)/t15-/m0/s1 |
| InChIKey | WLUKGYVGDZOYHB-HNNXBMFYSA-N |
| XLogP | 3.69 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|