C25H31ClN4O4 — CID 55328563
4-chloro-N-[3-methyl-1-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-1-oxobutan-2-yl]benzamide (PubChem CID 55328563) has the molecular formula C25H31ClN4O4 and a molecular weight of 487.00 g/mol. Its IUPAC name is 4-chloro-N-[3-methyl-1-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[3-methyl-1-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55328563 |
| Molecular Formula | C25H31ClN4O4 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-chloro-N-[3-methyl-1-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1)C(=O)N(C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H31ClN4O4/c1-17(2)23(28-24(32)18-4-6-19(26)7-5-18)25(33)29(3)16-22(31)27-20-8-10-21(11-9-20)30-12-14-34-15-13-30/h4-11,17,23H,12-16H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | BNEZXBRZYCYEHK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|