C21H15Cl2F3N2O3S — CID 28544429
2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 28544429) has the molecular formula C21H15Cl2F3N2O3S and a molecular weight of 503.33 g/mol. Its IUPAC name is 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 28544429 |
| Molecular Formula | C21H15Cl2F3N2O3S |
| Molecular Weight | 503.33 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | 2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1cc(Cl)ccc1Cl)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H15Cl2F3N2O3S/c22-14-6-7-15(23)18(10-14)32(30,31)28(11-13-4-2-1-3-5-13)12-19(29)27-17-9-8-16(24)20(25)21(17)26/h1-10H,11-12H2,(H,27,29) |
| InChIKey | BWHBEHWBVJSIRW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|