C24H22ClF3N2O3S — CID 28546584
2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 28546584) has the molecular formula C24H22ClF3N2O3S and a molecular weight of 510.97 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 28546584 |
| Molecular Formula | C24H22ClF3N2O3S |
| Molecular Weight | 510.97 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CC(=O)Nc2ccc(F)c(F)c2F)Cc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C24H22ClF3N2O3S/c1-14-10-15(2)24(16(3)11-14)34(32,33)30(12-17-4-6-18(25)7-5-17)13-21(31)29-20-9-8-19(26)22(27)23(20)28/h4-11H,12-13H2,1-3H3,(H,29,31) |
| InChIKey | ONYRKOOTNJVKHK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.97 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|