C23H29Cl2N3O4S — CID 4869538
2-[(2,5-dichlorophenyl)sulfonyl-(3-methoxypropyl)amino]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 4869538) has the molecular formula C23H29Cl2N3O4S and a molecular weight of 514.48 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonyl-(3-methoxypropyl)amino]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonyl-(3-methoxypropyl)amino]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4869538 |
| Molecular Formula | C23H29Cl2N3O4S |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonyl-(3-methoxypropyl)amino]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | COCCCN(CC(=O)Nc1ccc(N2CCCCC2)cc1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H29Cl2N3O4S/c1-32-15-5-14-28(33(30,31)22-16-18(24)6-11-21(22)25)17-23(29)26-19-7-9-20(10-8-19)27-12-3-2-4-13-27/h6-11,16H,2-5,12-15,17H2,1H3,(H,26,29) |
| InChIKey | XJQPMRXWYOKYNN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|