C23H28ClN3O5S — CID 26753912
[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 26753912) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 26753912 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)Nc2ccc(N3CCCC3)cc2)ccc1Cl |
| InChI | InChI=1S/C23H28ClN3O5S/c1-3-27(4-2)33(30,31)21-15-17(7-12-20(21)24)23(29)32-16-22(28)25-18-8-10-19(11-9-18)26-13-5-6-14-26/h7-12,15H,3-6,13-14,16H2,1-2H3,(H,25,28) |
| InChIKey | RTIBQXPSWKABRA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|