C24H30N4O7S — CID 3902679
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 3902679) has the molecular formula C24H30N4O7S and a molecular weight of 518.59 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 3902679 |
| Molecular Formula | C24H30N4O7S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H30N4O7S/c1-3-27(4-2)36(33,34)20-11-9-19(10-12-20)25-23(29)17-35-24(30)18-8-13-21(22(16-18)28(31)32)26-14-6-5-7-15-26/h8-13,16H,3-7,14-15,17H2,1-2H3,(H,25,29) |
| InChIKey | RDXCNWDVHRDJFH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|